Introduction：Basic information about CAS 1878-87-1|(2-Nitrophenoxy)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2-Nitrophenoxy)acetic acid |
|---|
| CAS Number | 1878-87-1 | Molecular Weight | 197.145 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 388.3±17.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H7NO5 | Melting Point | 157-160 °C(lit.) |
|---|
| MSDS | / | Flash Point | 188.7±20.9 °C |
|---|
Names
| Name | (2-nitrophenoxy)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 388.3±17.0 °C at 760 mmHg |
|---|
| Melting Point | 157-160 °C(lit.) |
|---|
| Molecular Formula | C8H7NO5 |
|---|
| Molecular Weight | 197.145 |
|---|
| Flash Point | 188.7±20.9 °C |
|---|
| Exact Mass | 197.032425 |
|---|
| PSA | 92.35000 |
|---|
| LogP | 0.94 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | TYHHDWAHJRRYCU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)COc1ccccc1[N+](=O)[O-] |
|---|
| Water Solubility | Soluble |
|---|
Safety Information
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R22;R36/37/38;R44 |
|---|
| Safety Phrases | S22-S24/25-S37/39-S26 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (2-Nitro-phenoxy)-essigsaeure |
| 2-Nitro-phenylaetherglykolsaeure |
| o-nitrophenoxy acetic acid |
| O-(2-Nitro-phenyl)-glykolsaeure |
| 2-Nitrophenoxyacetic Acid |
| (2-Nitrophenoxy)acetic acid |
| Acetic acid, 2-(2-nitrophenoxy)- |
| F0020-1820 |
| MFCD00016993 |
| EINECS 217-527-9 |
