Introduction：Basic information about CAS 342405-23-6|2-(benzylamino)-1,3-thiazole-5-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(benzylamino)-1,3-thiazole-5-carboxylic acid |
|---|
| CAS Number | 342405-23-6 | Molecular Weight | 234.27400 |
|---|
| Density | 1.421g/cm3 | Boiling Point | 460.7ºC at 760mmHg |
|---|
| Molecular Formula | C11H10N2O2S | Melting Point | 163ºC |
|---|
| MSDS | USA | Flash Point | 232.4ºC |
|---|
Names
| Name | 2-(benzylamino)-1,3-thiazole-5-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.421g/cm3 |
|---|
| Boiling Point | 460.7ºC at 760mmHg |
|---|
| Melting Point | 163ºC |
|---|
| Molecular Formula | C11H10N2O2S |
|---|
| Molecular Weight | 234.27400 |
|---|
| Flash Point | 232.4ºC |
|---|
| Exact Mass | 234.04600 |
|---|
| PSA | 90.46000 |
|---|
| LogP | 2.52640 |
|---|
| Index of Refraction | 1.7 |
|---|
| InChIKey | REVWBJBCAIBQGE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cnc(NCc2ccccc2)s1 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
Synonyms
| HMS1443E07 |
| 2-[benzylamino]-1,3-thiazole-5-carboxylic acid |
| 2-(3-CHLOROPHENOXY)MALONDIALDEHYDE |
