Introduction：Basic information about CAS 182344-22-5|(4-Pivalamidophenyl)boronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-Pivalamidophenyl)boronic acid |
|---|
| CAS Number | 182344-22-5 | Molecular Weight | 221.061 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C11H16BNO3 | Melting Point | 240-243ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [4-(2,2-dimethylpropanoylamino)phenyl]boronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Melting Point | 240-243ºC |
|---|
| Molecular Formula | C11H16BNO3 |
|---|
| Molecular Weight | 221.061 |
|---|
| Exact Mass | 221.122330 |
|---|
| PSA | 69.56000 |
|---|
| LogP | 1.68 |
|---|
| Index of Refraction | 1.532 |
|---|
| InChIKey | ORNCMGDXLWQRHH-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)C(=O)Nc1ccc(B(O)O)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
Synonyms
| {4-[(2,2-Dimethylpropanoyl)amino]phenyl}boronic acid |
| 4-Pivalamidobenzeneboronic acid |
| 4-Pivalamidophenylboronic acid |
| Boronic acid, B-[4-[(2,2-dimethyl-1-oxopropyl)amino]phenyl]- |
