Introduction：Basic information about CAS 71811-27-3|Z-Thr-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Thr-ol |
|---|
| CAS Number | 71811-27-3 | Molecular Weight | 239.26800 |
|---|
| Density | 1.218g/cm3 | Boiling Point | 456.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H17NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.7ºC |
|---|
Names
| Name | benzyl N-[(2R,3R)-1,3-dihydroxybutan-2-yl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.218g/cm3 |
|---|
| Boiling Point | 456.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H17NO4 |
|---|
| Molecular Weight | 239.26800 |
|---|
| Flash Point | 229.7ºC |
|---|
| Exact Mass | 239.11600 |
|---|
| PSA | 78.79000 |
|---|
| LogP | 1.04540 |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | KHJJQBXHWBLXPU-MWLCHTKSSA-N |
|---|
| SMILES | CC(O)C(CO)NC(=O)OCc1ccccc1 |
|---|
Synonyms
| Benzyl ((2R,3R)-1,3-dihydroxybutan-2-yl)carbamate |
| N-Carbobenzoxy-L-threoninol |
| Z-Thr-ol |
