Introduction:Basic information about CAS 101555-61-7|Boc-β-D-HomoPhe-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-β-D-HomoPhe-OH |
|---|
| CAS Number | 101555-61-7 | Molecular Weight | 279.332 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 444.8±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H21NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.8±26.8 °C |
|---|
Names
| Name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 444.8±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H21NO4 |
|---|
| Molecular Weight | 279.332 |
|---|
| Flash Point | 222.8±26.8 °C |
|---|
| Exact Mass | 279.147064 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 3.18 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.525 |
|---|
| InChIKey | ACKWQHCPHJQANL-GFCCVEGCSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22 |
|---|
| Safety Phrases | 24/25 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (R)-3-Boc-amino-4-phenylbutyric acid |
| (3S)-3-[(tert-Butoxycarbonyl)amino]-4-phenylbutanoic acid |
| MFCD01076270 |
| boc-d-phe-(c*ch2)oh |
| AmbotzBAA6100 |
| (3R)-3-[(tert-Butoxycarbonyl)amino]-4-phenylbutanoic acid |
| (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-phenylbutanoic acid |
| Benzenebutanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βR)- |
| Benzenebutanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-, (βS)- |
| (3S)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-phenylbutanoic acid |
| boc-(r)-3-amino-4-phenylbutyric acid |
| (R)-3-tert-Butoxycarbonylamino-4-phenylbutyricacid |
| (R)-3-((tert-butoxycarbonyl)amino)-4-phenylbutanoic acid |
| Boc-β-D-HomoPhe-OH |