Introduction:Basic information about CAS 100-93-6|Benzenesulfonamide,4-methyl-N-[4-(phenylamino)phenyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonamide,4-methyl-N-[4-(phenylamino)phenyl]- |
|---|
| CAS Number | 100-93-6 | Molecular Weight | 338.42300 |
|---|
| Density | 1.297g/cm3 | Boiling Point | 521ºC at 760mmHg |
|---|
| Molecular Formula | C19H18N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 268.9ºC |
|---|
Names
| Name | N-(4-anilinophenyl)-4-methylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.297g/cm3 |
|---|
| Boiling Point | 521ºC at 760mmHg |
|---|
| Molecular Formula | C19H18N2O2S |
|---|
| Molecular Weight | 338.42300 |
|---|
| Flash Point | 268.9ºC |
|---|
| Exact Mass | 338.10900 |
|---|
| PSA | 66.58000 |
|---|
| LogP | 5.76620 |
|---|
| Vapour Pressure | 5.89E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | KEZPMZSDLBJCHH-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Nc3ccccc3)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 4'-anilinotoluene-4-sulfonanilide |
| p-(p-Toluenesulfonamido)diphenylamine |
| Toluol-4-sulfonsaeure-(4-anilino-anilid) |
| 4-(p-toluenesulfonamido)diphenylamine |
| N-phenyl-4-(p-toluenesulfonamido)aniline |
| 4-(p-toluenesulfamoyl)diphenylamine |
| Aranox |
| p-(p-Tolylsulfonylamino)diphenylamine |
| Benzenesulfonamide,4-methyl-N-[4-(phenylamino)phenyl] |
| N'-(Toluol-sulfonyl-(4))-N-phenyl-p-phenylendiamin |
| toluene-4-sulfonic acid-(4-anilino-anilide) |
| 4-methyl-N-[4-(phenylamino)phenyl]benzenesulfonamide |