Introduction：Basic information about CAS 16971-82-7|hydrogen bis[benzene-o-diolato(2-)-O,O']borate(1-), compound with N,N', including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | hydrogen bis[benzene-o-diolato(2-)-O,O']borate(1-), compound with N,N'-di-o-tolylguanidine (1:1) |
|---|
| CAS Number | 16971-82-7 | Molecular Weight | 484.33100 |
|---|
| Density | / | Boiling Point | 396.1ºC at 760mmHg |
|---|
| Molecular Formula | C27H27BN3O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.3ºC |
|---|
Names
| Name | di-ortho-tolylguanidine salt of dicatechol borate |
|---|
Chemical & Physical Properties
| Boiling Point | 396.1ºC at 760mmHg |
|---|
| Molecular Formula | C27H27BN3O5 |
|---|
| Molecular Weight | 484.33100 |
|---|
| Flash Point | 193.3ºC |
|---|
| Exact Mass | 484.20400 |
|---|
| PSA | 135.09000 |
|---|
| LogP | 6.07120 |
|---|
| Vapour Pressure | 1.75E-06mmHg at 25°C |
|---|
| InChIKey | AWQDEOGKJWZKBI-UHFFFAOYSA-O |
|---|
| SMILES | Cc1ccccc1[NH+](C(=N)N)c1ccccc1C.[O-]B(Oc1ccccc1O)Oc1ccccc1O |
|---|
