Introduction：Basic information about CAS 78606-96-9|2-[(2-methylphenyl)methyl]propanedioic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(2-methylphenyl)methyl]propanedioic acid |
|---|
| CAS Number | 78606-96-9 | Molecular Weight | 208.21100 |
|---|
| Density | 1.291g/cm3 | Boiling Point | 393ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.6ºC |
|---|
Names
| Name | 2-[(2-methylphenyl)methyl]propanedioic acid |
|---|
Chemical & Physical Properties
| Density | 1.291g/cm3 |
|---|
| Boiling Point | 393ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12O4 |
|---|
| Molecular Weight | 208.21100 |
|---|
| Flash Point | 205.6ºC |
|---|
| Exact Mass | 208.07400 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 1.32290 |
|---|
| Index of Refraction | 1.571 |
|---|
| InChIKey | YVWCGEMMBLBBOC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccccc1CC(C(=O)O)C(=O)O |
|---|
