Introduction：Basic information about CAS 335-44-4|heptafluoro-2,3,3-trichlorobutane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | heptafluoro-2,3,3-trichlorobutane |
|---|
| CAS Number | 335-44-4 | Molecular Weight | 287.39100 |
|---|
| Density | 1.748 | Boiling Point | 98 °C |
|---|
| Molecular Formula | C4Cl3F7 | Melting Point | 4°C |
|---|
| MSDS | / | Flash Point | 97-98°C |
|---|
Names
| Name | 2,2,3-trichloro-1,1,1,3,4,4,4-heptafluorobutane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.748 |
|---|
| Boiling Point | 98 °C |
|---|
| Melting Point | 4°C |
|---|
| Molecular Formula | C4Cl3F7 |
|---|
| Molecular Weight | 287.39100 |
|---|
| Flash Point | 97-98°C |
|---|
| Exact Mass | 285.89500 |
|---|
| LogP | 4.18950 |
|---|
| Index of Refraction | 1.353 |
|---|
| InChIKey | ZPGMWBFCBUKITA-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(Cl)C(Cl)(Cl)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| hepta-fluoro-2,3,3-trichlorobutane |
| 2,2,3-Trichloroheptafluorobutane |
| MFCD00018065 |
| 2,2,3-trichloro-1,1,1,3,4,4,4-heptafluoro-butane |
| HEPTAFLUORO-2,2,3-TRICHLOROBUTANE |
| Heptafluoro-2,3,3-trichlorobutane |
| Butane,2,2,3-trichloro-1,1,1,3,4,4,4-heptafluoro |
| 2,2,3-Trichlor-heptafluor-butan |
