Introduction：Basic information about CAS 6304-46-7|1-Naphthalenol,5-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Naphthalenol,5-nitro- |
|---|
| CAS Number | 6304-46-7 | Molecular Weight | 189.16700 |
|---|
| Density | 1.441g/cm3 | Boiling Point | 550.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 286.9ºC |
|---|
Names
| Name | 5-Nitro-1-naphthol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.441g/cm3 |
|---|
| Boiling Point | 550.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7NO3 |
|---|
| Molecular Weight | 189.16700 |
|---|
| Flash Point | 286.9ºC |
|---|
| Exact Mass | 189.04300 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 2.97680 |
|---|
| Index of Refraction | 1.727 |
|---|
| InChIKey | RIXNIZKEKXPLIT-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc2c(O)cccc12 |
|---|
Safety Information
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 5-Nitro-naphthoesaeure-1-methylester |
| methyl 5-nitro-1-naphthoate |
| 5-nitro-1-naphthalenol |
| 1-Hydroxy-5-nitronaphthalin |
| 5-Nitro-naphthalene-1-carboxylic acid methyl ester |
| 5-Nitro-1-hydroxy-naphthalin |
| 1-nitro-5-hydroxy-naphthalene |
