Introduction:Basic information about CAS 718-36-5|p-nitrobenzylidene tert-butylamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-nitrobenzylidene tert-butylamine |
|---|
| CAS Number | 718-36-5 | Molecular Weight | 206.24100 |
|---|
| Density | 1.06g/cm3 | Boiling Point | 312.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H14N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.7ºC |
|---|
Names
| Name | p-nitrobenzylidene tert-butylamine |
|---|
Chemical & Physical Properties
| Density | 1.06g/cm3 |
|---|
| Boiling Point | 312.3ºC at 760 mmHg |
|---|
| Molecular Formula | C11H14N2O2 |
|---|
| Molecular Weight | 206.24100 |
|---|
| Flash Point | 142.7ºC |
|---|
| Exact Mass | 206.10600 |
|---|
| PSA | 58.18000 |
|---|
| LogP | 3.33540 |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | BZCRPTQYJYKZDH-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)N=Cc1ccc([N+](=O)[O-])cc1 |
|---|