Introduction：Basic information about CAS 72467-44-8|piclonidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | piclonidine |
|---|
| CAS Number | 72467-44-8 | Molecular Weight | 314.21000 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 429.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H17Cl2N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 213.3ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 429.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H17Cl2N3O |
|---|
| Molecular Weight | 314.21000 |
|---|
| Flash Point | 213.3ºC |
|---|
| Exact Mass | 313.07500 |
|---|
| PSA | 36.86000 |
|---|
| LogP | 3.05000 |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | NYQGJEQCYOJBPV-UHFFFAOYSA-N |
|---|
| SMILES | Clc1cccc(Cl)c1N(C1=NCCN1)C1CCCCO1 |
|---|
