Introduction:Basic information about CAS 77342-26-8|Tefenperate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tefenperate |
|---|
| CAS Number | 77342-26-8 | Molecular Weight | 534.51400 |
|---|
| Density | 1.153g/cm3 | Boiling Point | 588.7ºC at 760 mmHg |
|---|
| Molecular Formula | C29H37Cl2NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 309.8ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.153g/cm3 |
|---|
| Boiling Point | 588.7ºC at 760 mmHg |
|---|
| Molecular Formula | C29H37Cl2NO4 |
|---|
| Molecular Weight | 534.51400 |
|---|
| Flash Point | 309.8ºC |
|---|
| Exact Mass | 533.21000 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 6.60470 |
|---|
| Index of Refraction | 1.536 |
|---|
| InChIKey | YDDUWJJLKQBFMH-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OC(Cc1ccccc1Cl)(Cc1ccccc1Cl)C(=O)OCCN1C(C)(C)CCCC1(C)C |
|---|