Introduction：Basic information about CAS 58524-83-7|ciprocinonide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ciprocinonide |
|---|
| CAS Number | 58524-83-7 | Molecular Weight | 520.56200 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 621.1ºC at 760mmHg |
|---|
| Molecular Formula | C28H34F2O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 329.4ºC |
|---|
Names
| Name | ciprocinonide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 621.1ºC at 760mmHg |
|---|
| Molecular Formula | C28H34F2O7 |
|---|
| Molecular Weight | 520.56200 |
|---|
| Flash Point | 329.4ºC |
|---|
| Exact Mass | 520.22700 |
|---|
| PSA | 99.13000 |
|---|
| LogP | 3.32770 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | TZBDXWBBMOEVPI-XBQQDWOSSA-N |
|---|
| SMILES | CC1(C)OC2CC3C4CC(F)C5=CC(=O)C=CC5(C)C4(F)C(O)CC3(C)C2(C(=O)COC(=O)C2CC2)O1 |
|---|
Synonyms
| RS 2386 |
| Fluocinolone Acetonide 21-Cyclopropylcarboxylate |
| Ciprocinonide (USAN/INN) |
