Introduction:Basic information about CAS 82317-83-7|Boc-D-4-Trifluoromethylphe, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-D-4-Trifluoromethylphe |
|---|
| CAS Number | 82317-83-7 | Molecular Weight | 333.303 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 431.4±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H18F3NO4 | Melting Point | 135-140ºC |
|---|
| MSDS | USA | Flash Point | 214.7±28.7 °C |
|---|
Names
| Name | Boc-4-(trifluoromethyl)-D-phenylalanine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 431.4±45.0 °C at 760 mmHg |
|---|
| Melting Point | 135-140ºC |
|---|
| Molecular Formula | C15H18F3NO4 |
|---|
| Molecular Weight | 333.303 |
|---|
| Flash Point | 214.7±28.7 °C |
|---|
| Exact Mass | 333.118805 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 3.54 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.487 |
|---|
| InChIKey | SMVCCWNHCHCWAZ-LLVKDONJSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(C(F)(F)F)cc1)C(=O)O |
|---|
| Storage condition | Keep Cold |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-L-phenylalanine |
| MFCD00797557 |
| BOC-D-4-Trifluoromethylphe |
| (2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| N-(tert-Butoxycarbonyl)-4-(trifluormethyl)-L-phenylalanin |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(trifluoromethyl)-D-phenylalanine |
| D-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-4-(trifluoromethyl)- |
| N-(tert-Butoxycarbonyl)-4-(trifluormethyl)-D-phenylalanin |
| Boc-D-phe(4-CF3)-OH |
| (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-4-(trifluoromethyl)- |
| N-(tert-Butoxycarbonyl)-4-(trifluoromethyl)-L-phenylalanine |
| N-(tert-Butoxycarbonyl)-4-(trifluoromethyl)-D-phenylalanine |
| Boc-D-Phe(4-CF3)-OH.HCl |