Introduction：Basic information about CAS 49769-78-0|Dimethyl Benzylmalonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dimethyl Benzylmalonate |
|---|
| CAS Number | 49769-78-0 | Molecular Weight | 222.23700 |
|---|
| Density | 1.13 | Boiling Point | 285ºC |
|---|
| Molecular Formula | C12H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 139.5ºC |
|---|
Names
| Name | dimethyl 2-benzylpropanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.13 |
|---|
| Boiling Point | 285ºC |
|---|
| Molecular Formula | C12H14O4 |
|---|
| Molecular Weight | 222.23700 |
|---|
| Flash Point | 139.5ºC |
|---|
| Exact Mass | 222.08900 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 1.19130 |
|---|
| Index of Refraction | 1.503 |
|---|
| InChIKey | ZMYJSOIMFGAQRQ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(Cc1ccccc1)C(=O)OC |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| dimethylbenzylmalonate |
| 2-benzyl dimethylmalonate |
| 2-benzyl-malonic acid dimethyl ester |
| DiMethyl BenzylMalonate |
| Dimethyl 2-benzylmalonate |
| Benzylmalonic Acid Dimethyl Ester |
