Introduction：Basic information about CAS 82780-78-7|4-Methoxy-2-nitro-1-(phenylmethoxy)benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Methoxy-2-nitro-1-(phenylmethoxy)benzene |
|---|
| CAS Number | 82780-78-7 | Molecular Weight | 259.25700 |
|---|
| Density | 1.234 | Boiling Point | 428.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H13NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191ºC |
|---|
Names
| Name | 4-methoxy-2-nitro-1-phenylmethoxybenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.234 |
|---|
| Boiling Point | 428.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H13NO4 |
|---|
| Molecular Weight | 259.25700 |
|---|
| Flash Point | 191ºC |
|---|
| Exact Mass | 259.08400 |
|---|
| PSA | 64.28000 |
|---|
| LogP | 3.70560 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | AQXBISNAILQFMY-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(OCc2ccccc2)c([N+](=O)[O-])c1 |
|---|
Synonyms
| 1-benzyloxy-4-methoxy-2-nitro-benzene |
| 6-benzyloxy-3-methoxynitrobenzene |
| 1-Benzyloxy-4-methoxy-2-nitro-benzol |
| 4-methoxy-2-nitro-1-phenylmethoxy-benzene |
