Introduction：Basic information about CAS 107202-43-7|(3S)-3-(N-Boc-amino)-4-phenyl-1-butene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3S)-3-(N-Boc-amino)-4-phenyl-1-butene |
|---|
| CAS Number | 107202-43-7 | Molecular Weight | 247.33300 |
|---|
| Density | 1.007g/cm3 | Boiling Point | 361.871ºC at 760 mmHg |
|---|
| Molecular Formula | C15H21NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 172.654ºC |
|---|
Names
| Name | (S)-3-Boc-amino-4-phenyl-1-butene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.007g/cm3 |
|---|
| Boiling Point | 361.871ºC at 760 mmHg |
|---|
| Molecular Formula | C15H21NO2 |
|---|
| Molecular Weight | 247.33300 |
|---|
| Flash Point | 172.654ºC |
|---|
| Exact Mass | 247.15700 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 3.69930 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.508 |
|---|
| InChIKey | WNAHEVXTGAEKIY-CYBMUJFWSA-N |
|---|
| SMILES | C=CC(Cc1ccccc1)NC(=O)OC(C)(C)C |
|---|
Synonyms
| (3S)-3-tert-butoxycarbonylamino-4-phenyl-1-butene |
| (S)-3-tert-butoxycarbonylamino-4-phenyl-1-butene |
| [(1S)-1-(Phenylmethyl)-2-propenyl]carbamic Acid1,1-Dimethylethyl Ester |
| N-[(1S)-1-(Phenylmethyl)-2-propen-1-yl]carbamic Acid,1-Dimethylethyl Ester |
| 3(S)-<(tert-butyloxycarbonyl)amino>-4-phenyl-1-butene |
| (S)-2-(tert-butoxycarbonylamino)-1-phenylbut-3-ene |
| (S)-tert-Butyl 1-phenylbut-3-en-2-ylcarbamate |
| ((S)-1-benzylallyl)carbamic acid tert-butyl ester |
| (3S)-3-(N-Boc-amino)-4-phenyl-1-butene |
| (3S)-3-N-tert-butoxycarbonylamino-4-phenyl-1-butene |
