Introduction：Basic information about CAS 87694-53-9|boc-phe-n(och3)ch3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | boc-phe-n(och3)ch3 |
|---|
| CAS Number | 87694-53-9 | Molecular Weight | 308.373 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C16H24N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | tert-butyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Molecular Formula | C16H24N2O4 |
|---|
| Molecular Weight | 308.373 |
|---|
| Exact Mass | 308.173615 |
|---|
| PSA | 67.87000 |
|---|
| LogP | 3.00 |
|---|
| Index of Refraction | 1.514 |
|---|
| InChIKey | ZAHRDPIWMGLOQJ-ZDUSSCGKSA-N |
|---|
| SMILES | CON(C)C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
|---|
| Storage condition | Store at 0°C |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| [(1S)-(Methoxy-methyl-carbamoyl)-2-phenyl-ethyl]-carbamic acid tert-butyl ester |
| [(1S)-2-(methoxymethylamino)-2-oxo-1-(phenylmethyl)ethyl]carbamic acid 1,1-dimethylethyl ester |
| tert-butyl cis-N-(2-aminocyclohexyl)carbamate |
| CarbaMic acid,(2-aMinocyclohexyl)-,1,1-diMethylethyl ester,cis |
| 1-N-Boc-1,2-cis-cyclohexyldiamine (Racemic) |
| boc-Phe-N(OCH3)CH3 |
| 1-N-Boc-cis-1,2-cyclohexyldiamine |
| cis-2-(Boc-amino)cyclohexylamine |
| Carbamic acid, N-[(1S)-2-(methoxymethylamino)-2-oxo-1-(phenylmethyl)ethyl]-, 1,1-dimethylethyl ester |
| tert-butyl (cis-2-aminocyclohexyl)carbamate |
| N-Boc-cis-1,2-cyclohexanediaMine |
| N-Boc-L-phenylalanine N'-methoxy-N'-methylamide |
| tert-butyl (1RS,2SR)-2-aminocyclohexylcarbamate |
| N-Methoxy-N-methyl-Nα-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalaninamide |
| Nα-(tert-Butoxycarbonyl)-N-methoxy-N-methyl-L-phenylalaninamide |
| tert-butyl (1S)-1-benzyl-2-[methoxy(methyl)amino]-2-oxoethylcarbamate |
