Introduction:Basic information about CAS 135865-78-0|(S)-tert-Butyl 3-oxo-1-phenylpropylcarbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-tert-Butyl 3-oxo-1-phenylpropylcarbamate |
|---|
| CAS Number | 135865-78-0 | Molecular Weight | 249.306 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 371.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 178.7±25.9 °C |
|---|
Names
| Name | N-Boc-(3S)-3-phenyl-3-aminopropionaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 371.9±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H19NO3 |
|---|
| Molecular Weight | 249.306 |
|---|
| Flash Point | 178.7±25.9 °C |
|---|
| Exact Mass | 249.136490 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 2.91 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.508 |
|---|
| InChIKey | ZGPCDZZHEWGTEU-LBPRGKRZSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CC=O)c1ccccc1 |
|---|
Safety Information
Synonyms
| tert-butyl [(S)-2-formyl-1-phenylethyl]carbamate |
| (S)-tert-Butyl3-oxo-1-phenylpropylcarbamate |
| tert-Butyl (1S)-3-oxo-1-phenylpropylcarbamate |
| ((S)-3-oxo-1-phenylpropyl)carbamic acid tert-butyl ester |
| Carbamic acid, N-[(1S)-3-oxo-1-phenylpropyl]-, 1,1-dimethylethyl ester |
| Boc-(S)-3-Amino-3-phenylpropanal |
| tert-butyl 2-aMino-4-oxo-2-phenylbutanoate |
| 2-Methyl-2-propanyl [(1S)-3-oxo-1-phenylpropyl]carbamate |
| Maraviroc Intermediate 3 |
| Maraviroc interMediate(aMino acid) |
| N-[(1S)-3-Oxo-1-phenylpropyl] |