Introduction:Basic information about CAS 921938-54-7|3-(4-isocyanatophenyl)-1-methylpyrazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-isocyanatophenyl)-1-methylpyrazole |
|---|
| CAS Number | 921938-54-7 | Molecular Weight | 199.20900 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 333.7ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9N3O | Melting Point | 67ºC |
|---|
| MSDS | / | Flash Point | 155.6ºC |
|---|
Names
| Name | 3-(4-isocyanatophenyl)-1-methylpyrazole |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 333.7ºC at 760 mmHg |
|---|
| Melting Point | 67ºC |
|---|
| Molecular Formula | C11H9N3O |
|---|
| Molecular Weight | 199.20900 |
|---|
| Flash Point | 155.6ºC |
|---|
| Exact Mass | 199.07500 |
|---|
| PSA | 47.25000 |
|---|
| LogP | 2.05440 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | ZKEJKACUGXVHKW-UHFFFAOYSA-N |
|---|
| SMILES | Cn1ccc(-c2ccc(N=C=O)cc2)n1 |
|---|