Introduction：Basic information about CAS 926921-65-5|3-(6-methylpyrazin-2-yl)oxybenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(6-methylpyrazin-2-yl)oxybenzenesulfonyl chloride |
|---|
| CAS Number | 926921-65-5 | Molecular Weight | 284.71900 |
|---|
| Density | 1.427g/cm3 | Boiling Point | 415.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9ClN2O3S | Melting Point | 83-85.5ºC |
|---|
| MSDS | / | Flash Point | 205.3ºC |
|---|
Names
| Name | 3-(6-methylpyrazin-2-yl)oxybenzenesulfonyl chloride |
|---|
Chemical & Physical Properties
| Density | 1.427g/cm3 |
|---|
| Boiling Point | 415.9ºC at 760 mmHg |
|---|
| Melting Point | 83-85.5ºC |
|---|
| Molecular Formula | C11H9ClN2O3S |
|---|
| Molecular Weight | 284.71900 |
|---|
| Flash Point | 205.3ºC |
|---|
| Exact Mass | 284.00200 |
|---|
| PSA | 77.53000 |
|---|
| LogP | 3.58560 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | TZKVHSNSPBZGTE-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cncc(Oc2cccc(S(=O)(=O)Cl)c2)n1 |
|---|
