Introduction：Basic information about CAS 921938-98-9|2-(4-isocyanatophenoxy)-6-methylpyrazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-isocyanatophenoxy)-6-methylpyrazine |
|---|
| CAS Number | 921938-98-9 | Molecular Weight | 227.21900 |
|---|
| Density | 1.22g/cm3 | Boiling Point | 342.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9N3O2 | Melting Point | >50ºC |
|---|
| MSDS | / | Flash Point | 160.9ºC |
|---|
Names
| Name | 2-(4-isocyanatophenoxy)-6-methylpyrazine |
|---|
Chemical & Physical Properties
| Density | 1.22g/cm3 |
|---|
| Boiling Point | 342.4ºC at 760 mmHg |
|---|
| Melting Point | >50ºC |
|---|
| Molecular Formula | C12H9N3O2 |
|---|
| Molecular Weight | 227.21900 |
|---|
| Flash Point | 160.9ºC |
|---|
| Exact Mass | 227.06900 |
|---|
| PSA | 64.44000 |
|---|
| LogP | 2.54460 |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | ABVOFXCRJAZHGH-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cncc(Oc2ccc(N=C=O)cc2)n1 |
|---|
