Introduction：Basic information about CAS 926921-61-1|ethyl 1-(6-methylpyrazin-2-yl)piperidine-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 1-(6-methylpyrazin-2-yl)piperidine-3-carboxylate |
|---|
| CAS Number | 926921-61-1 | Molecular Weight | 249.30900 |
|---|
| Density | 1.14g/cm3 | Boiling Point | 384.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H19N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 186.5ºC |
|---|
Names
| Name | ethyl 1-(6-methylpyrazin-2-yl)piperidine-3-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.14g/cm3 |
|---|
| Boiling Point | 384.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H19N3O2 |
|---|
| Molecular Weight | 249.30900 |
|---|
| Flash Point | 186.5ºC |
|---|
| Exact Mass | 249.14800 |
|---|
| PSA | 55.32000 |
|---|
| LogP | 1.62950 |
|---|
| Index of Refraction | 1.531 |
|---|
| InChIKey | MTWGDARCNWTWJN-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1CCCN(c2cncc(C)n2)C1 |
|---|
