Introduction:Basic information about CAS 4705-34-4|4, 4-Dimethoxystilbene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4, 4-Dimethoxystilbene |
|---|
| CAS Number | 4705-34-4 | Molecular Weight | 240.29700 |
|---|
| Density | 1.089g/cm3 | Boiling Point | 391.3ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O2 | Melting Point | 213-215ºC |
|---|
| MSDS | / | Flash Point | 159.3ºC |
|---|
Names
| Name | 1-methoxy-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.089g/cm3 |
|---|
| Boiling Point | 391.3ºC at 760 mmHg |
|---|
| Melting Point | 213-215ºC |
|---|
| Molecular Formula | C16H16O2 |
|---|
| Molecular Weight | 240.29700 |
|---|
| Flash Point | 159.3ºC |
|---|
| Exact Mass | 240.11500 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 3.87420 |
|---|
| Index of Refraction | 1.615 |
|---|
| InChIKey | CAWFCZIEFIQKRV-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C=Cc2ccc(OC)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/38 |
|---|
| Safety Phrases | S24/25 |
|---|
Synonyms
| EINECS 225-189-9 |
| trans-4,4-dimethoxystilbene |
| 4,4‘-Dimethoxystilbene |
| 1,1'-(E)-ethene-1,2-diylbis(4-methoxybenzene) |
| Stilbene,4'-dimethoxy |
| Bianisal |
| Photoanethole |
| 1,2-di(p-methoxyphenyl)ethylene |
| p,p'-Dimethoxystilbene |
| 1,1'-[(1E)-ethane-1,2-diyl]bis[4-methoxybenzene] |
| MFCD00008414 |
| 4,4'-DIMETHOXYSTILBENE |
| Bianisylidene |