Introduction：Basic information about CAS 6307-70-6|Benzoic acid, 2,6-dimethyl-3-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid, 2,6-dimethyl-3-nitro- |
|---|
| CAS Number | 6307-70-6 | Molecular Weight | 195.17200 |
|---|
| Density | 1.333g/cm3 | Boiling Point | 358.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158.7ºC |
|---|
Names
| Name | 2,6-dimethyl-3-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.333g/cm3 |
|---|
| Boiling Point | 358.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9NO4 |
|---|
| Molecular Weight | 195.17200 |
|---|
| Flash Point | 158.7ºC |
|---|
| Exact Mass | 195.05300 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.43300 |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | GOGALNMBJIGJNW-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc([N+](=O)[O-])c(C)c1C(=O)O |
|---|
Synonyms
| 2,6-Diemthyl-3-nitro-benzoesaeure |
| 2,6-Dimethyl-3-nitrobenzoesaeure |
| 2,6-dimethyl-3-nitro-benzoic acid |
| 3-Nitro-2,6-dimethyl-benzoesaeure |
| 3-nitro-2,6-dimethylbenzoic acid |
