Introduction：Basic information about CAS 82-16-6|1,8-bis[(4-methylphenyl)amino]anthraquinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,8-bis[(4-methylphenyl)amino]anthraquinone |
|---|
| CAS Number | 82-16-6 | Molecular Weight | 418.48600 |
|---|
| Density | 1.292g/cm3 | Boiling Point | 633.8ºC at 760mmHg |
|---|
| Molecular Formula | C28H22N2O2 | Melting Point | > 250°C (lit.) |
|---|
| MSDS | / | Flash Point | 197ºC |
|---|
Names
| Name | 1,8-bis(4-methylanilino)anthracene-9,10-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.292g/cm3 |
|---|
| Boiling Point | 633.8ºC at 760mmHg |
|---|
| Melting Point | > 250°C (lit.) |
|---|
| Molecular Formula | C28H22N2O2 |
|---|
| Molecular Weight | 418.48600 |
|---|
| Flash Point | 197ºC |
|---|
| Exact Mass | 418.16800 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 6.71200 |
|---|
| Index of Refraction | 1.714 |
|---|
| InChIKey | YNPQDABMOAMHNC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(Nc2cccc3c2C(=O)c2c(Nc4ccc(C)cc4)cccc2C3=O)cc1 |
|---|
Synonyms
| 1,8-di-p-toluidino-anthraquinone |
| 1,8-Di-p-toluidino-anthrachinon |
| 1.8-Bis-(p-methyl-phenylamino)-anthrachinon |
| 1,8-Bis-p-tolylamino-anthraquinone |
| 9,10-Anthracenedione,1,8-bis[(4-methylphenyl)amino] |
| 1,8-Bis((4-methylphenyl)amino)anthraquinone |
