Introduction：Basic information about CAS 490-49-3|(-)-EPICEDROL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (-)-EPICEDROL |
|---|
| CAS Number | 490-49-3 | Molecular Weight | 274.26900 |
|---|
| Density | 1.492 g/cm3 | Boiling Point | 568.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 297.4ºC |
|---|
Names
| Name | fisetinidol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.492 g/cm3 |
|---|
| Boiling Point | 568.2ºC at 760 mmHg |
|---|
| Molecular Formula | C15H14O5 |
|---|
| Molecular Weight | 274.26900 |
|---|
| Flash Point | 297.4ºC |
|---|
| Exact Mass | 274.08400 |
|---|
| PSA | 90.15000 |
|---|
| LogP | 1.84050 |
|---|
| Vapour Pressure | 9.49E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.708 |
|---|
| InChIKey | VFZYLYJWCROVLO-DZGCQCFKSA-N |
|---|
| SMILES | Oc1ccc2c(c1)OC(c1ccc(O)c(O)c1)C(O)C2 |
|---|
Synonyms
| (2R,3S)-2,3-trans-3',4',7-trihydroxyflavan-3-ol |
| (-)-robinetinidol |
| Fischersaeure |
| fischeric acid |
| (2R)-2r-(3,4-Dihydroxy-phenyl)-chroman-3t,7-diol |
| (-)-FISETINIDOL |
| Cyclodeca[b]furan-6-carboxylicacid,4,7,8,11-tetrahydro-3,10-dimethyl-,(5Z,9E) |
| (5Z,9E)-3,10-dimethyl-4,7,8,11-tetrahydro-cyclodeca[b]furan-6-carboxylic acid |
