Introduction：Basic information about CAS 23861-85-0|1-(4-Isothiocyanatophenyl)-4-methylpiperazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-Isothiocyanatophenyl)-4-methylpiperazine |
|---|
| CAS Number | 23861-85-0 | Molecular Weight | 233.33300 |
|---|
| Density | 1.15g/cm3 | Boiling Point | 381.016ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15N3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 184.232ºC |
|---|
Names
| Name | 1-(4-Isothiocyanatophenyl)-4-methylpiperazine |
|---|
Chemical & Physical Properties
| Density | 1.15g/cm3 |
|---|
| Boiling Point | 381.016ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15N3S |
|---|
| Molecular Weight | 233.33300 |
|---|
| Flash Point | 184.232ºC |
|---|
| Exact Mass | 233.09900 |
|---|
| PSA | 50.93000 |
|---|
| LogP | 2.17560 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | DXXKATNBNNUIAW-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCN(c2ccc(N=C=S)cc2)CC1 |
|---|
