Introduction:Basic information about CAS 17537-08-5|2-(2-Amino-5-chlorophenyl)-1H-isoindole-1,3(2H)-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-Amino-5-chlorophenyl)-1H-isoindole-1,3(2H)-dione |
|---|
| CAS Number | 17537-08-5 | Molecular Weight | 272.68600 |
|---|
| Density | 1.506g/cm3 | Boiling Point | 488.4ºC at 760 mmHg |
|---|
| Molecular Formula | C14H9ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 249.2ºC |
|---|
Names
| Name | 2-(2-Amino-5-chlorophenyl)-1H-isoindole-1,3(2H)-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.506g/cm3 |
|---|
| Boiling Point | 488.4ºC at 760 mmHg |
|---|
| Molecular Formula | C14H9ClN2O2 |
|---|
| Molecular Weight | 272.68600 |
|---|
| Flash Point | 249.2ºC |
|---|
| Exact Mass | 272.03500 |
|---|
| PSA | 63.40000 |
|---|
| LogP | 3.36900 |
|---|
| Vapour Pressure | 1.09E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.716 |
|---|
| InChIKey | CRWTYHALMKBXSE-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(Cl)cc1N1C(=O)c2ccccc2C1=O |
|---|
Synonyms
| 5-Pyrimidinecarbonyl chloride,4-chloro-2-phenyl |
| 4-chloro-2-phenyl-5-pyrimidinecarbonyl chloride |
| 4-Chloro-2-phthalimidoaniline |