Introduction:Basic information about CAS 33588-54-4|1-Acetyl-5-bromo-1H-indol-3-yl acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Acetyl-5-bromo-1H-indol-3-yl acetate |
|---|
| CAS Number | 33588-54-4 | Molecular Weight | 296.117 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 395.7±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H10BrNO3 | Melting Point | 125-128ºC |
|---|
| MSDS | USA | Flash Point | 193.1±22.3 °C |
|---|
Names
| Name | (1-acetyl-5-bromoindol-3-yl) acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 395.7±22.0 °C at 760 mmHg |
|---|
| Melting Point | 125-128ºC |
|---|
| Molecular Formula | C12H10BrNO3 |
|---|
| Molecular Weight | 296.117 |
|---|
| Flash Point | 193.1±22.3 °C |
|---|
| Exact Mass | 294.984406 |
|---|
| PSA | 48.30000 |
|---|
| LogP | 2.29 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | XJRIDJAGAYGJCK-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1cn(C(C)=O)c2ccc(Br)cc12 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-Bromo indoxyl diacetate |
| 1-Acetyl-5-bromoindol-3-ol acetate |
| 5-Bromoindoxyl diacetate |
| 3-acetoxy-1-acetyl-5-bromo-indole |
| Acetic acid 1-acetyl-5-bromo-1H-indol-3-; yl ester |
| bromo-5 diacetyl-1,3 indoxyle |
| Ethanone, 1-[3-(acetyloxy)-5-bromo-1H-indol-1-yl]- |
| 1H-Indol-3-ol, 1-acetyl-5-bromo-, acetate (ester) |
| EINECS 251-584-0 |
| 3-Acetoxy-1-acetyl-5-brom-indol |
| 5-bromo-O,N-acetylindoxyl |
| MFCD00005799 |
| 1H-Indol-3-ol,1-acetyl-5-bromo-,acetate |
| 1-Acetyl-5-bromo-1H-indol-3-yl acetate |
| 1-Acetyl-3-acetyloxy-5-bromoindole |
| N-acetyl-5-bromoindolyl acetate |
| 1-acetyl-3-acetoxy-5-bromo-3-indole |