Introduction：Basic information about CAS 189746-15-4|2,6-dimethoxy-4-methyl-8-nitro-5-[3-(trifluoromethyl)phenoxy]quinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-dimethoxy-4-methyl-8-nitro-5-[3-(trifluoromethyl)phenoxy]quinoline |
|---|
| CAS Number | 189746-15-4 | Molecular Weight | 408.32800 |
|---|
| Density | 1.375g/cm3 | Boiling Point | 487.337ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15F3N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 248.533ºC |
|---|
Names
| Name | 2,6-dimethoxy-4-methyl-8-nitro-5-[3-(trifluoromethyl)phenoxy]quinoline |
|---|
Chemical & Physical Properties
| Density | 1.375g/cm3 |
|---|
| Boiling Point | 487.337ºC at 760 mmHg |
|---|
| Molecular Formula | C19H15F3N2O5 |
|---|
| Molecular Weight | 408.32800 |
|---|
| Flash Point | 248.533ºC |
|---|
| Exact Mass | 408.09300 |
|---|
| PSA | 86.40000 |
|---|
| LogP | 5.80290 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | UUMJUNBCKSPWGX-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C)c2c(Oc3cccc(C(F)(F)F)c3)c(OC)cc([N+](=O)[O-])c2n1 |
|---|
