Introduction：Basic information about CAS 64-95-9|2-(diethylamino)ethyl 2,2-diphenylacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(diethylamino)ethyl 2,2-diphenylacetate |
|---|
| CAS Number | 64-95-9 | Molecular Weight | 311.41800 |
|---|
| Density | 1.052g/cm3 | Boiling Point | 423ºC at 760 mmHg |
|---|
| Molecular Formula | C20H25NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 133.2ºC |
|---|
Names
| Name | 2-(diethylamino)ethyl 2,2-diphenylacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.052g/cm3 |
|---|
| Boiling Point | 423ºC at 760 mmHg |
|---|
| Molecular Formula | C20H25NO2 |
|---|
| Molecular Weight | 311.41800 |
|---|
| Flash Point | 133.2ºC |
|---|
| Exact Mass | 311.18900 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 3.70350 |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | JGOAIQNSOGZNBX-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCOC(=O)C(c1ccccc1)c1ccccc1 |
|---|
Synonyms
| Transentine |
| Tranzetil |
| Difacil |
| Diphacyl |
| Diphenylessigsaeure-<2-diaethylamino-aethylester> |
| Spasmolytin |
| Trasentine |
| adiphenine |
| Patrovine |
| Adiphenin |
| Diphacil |
