Introduction：Basic information about CAS 6505-29-9|4,4'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[2,4-dihydr, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-[(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-one] |
|---|
| CAS Number | 6505-29-9 | Molecular Weight | 614.65300 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 829.2ºC at 760 mmHg |
|---|
| Molecular Formula | C34H30N8O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 455.3ºC |
|---|
Names
| Name | 4-[[2-methoxy-4-[3-methoxy-4-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]phenyl]phenyl]diazenyl]-5-methyl-2-phenyl-4H-pyrazol-3-one |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 829.2ºC at 760 mmHg |
|---|
| Molecular Formula | C34H30N8O4 |
|---|
| Molecular Weight | 614.65300 |
|---|
| Flash Point | 455.3ºC |
|---|
| Exact Mass | 614.23900 |
|---|
| PSA | 133.24000 |
|---|
| LogP | 6.12200 |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | ROBHRZYBQRKAQY-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(-c2ccc(N=NC3C(=O)N(c4ccccc4)N=C3C)c(OC)c2)ccc1N=NC1C(=O)N(c2ccccc2)N=C1C |
|---|
