Introduction：Basic information about CAS 65738-56-9|methyl 5-chloro-1-oxo-2,3-dihydro-1H-indene-2-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 5-chloro-1-oxo-2,3-dihydro-1H-indene-2-carboxylate |
|---|
| CAS Number | 65738-56-9 | Molecular Weight | 224.64000 |
|---|
| Density | 1.365g/cm3 | Boiling Point | 346.015ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150.575ºC |
|---|
Names
| Name | methyl 6-chloro-3-oxo-1,2-dihydroindene-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.365g/cm3 |
|---|
| Boiling Point | 346.015ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9ClO3 |
|---|
| Molecular Weight | 224.64000 |
|---|
| Flash Point | 150.575ºC |
|---|
| Exact Mass | 224.02400 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 1.86800 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | BYUCBODSULLYIS-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C1Cc2cc(Cl)ccc2C1=O |
|---|
| Storage condition | 2-8℃ |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 1H-Indene-2-carboxylic acid,5-chloro-2,3-dihydro-1-oxo-,methyl ester |
| 2-carbomethoxy-5-chloro-1-indanone |
| 2-carbomethoxy-5-chloroindanone |
| methyl 5-chloro-1-oxoindane-2-carboxylate |
| methyl 5-chloro-1-oxo-2-indanecarboxylate |
| methyl 5-chloro-1-oxo-2,3-dihydroindene-2-carboxylate |
| 5-chloro-1-oxoindan-2-carboxylic acid methyl ester |
| methyl 5-chloro-1-oxo-2,3-dihydro-1H-indene-2-carboxylate |
