Introduction:Basic information about CAS 65749-37-3|3-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]-N-[4-[4-[ethyl(2-hydroxyethyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]-N-[4-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]imino-5-oxo-1-(2,4,6-trichlorophenyl)pyrazol-3-yl]benzamide |
|---|
| CAS Number | 65749-37-3 | Molecular Weight | 862.28300 |
|---|
| Density | 1.26 | Boiling Point | / |
|---|
| Molecular Formula | C45H51Cl3N6O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]-N-[4-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]imino-5-oxo-1-(2,4,6-trichlorophenyl)pyrazol-3-yl]benzamide |
|---|
Chemical & Physical Properties
| Density | 1.26 |
|---|
| Molecular Formula | C45H51Cl3N6O5 |
|---|
| Molecular Weight | 862.28300 |
|---|
| Exact Mass | 860.29900 |
|---|
| PSA | 139.42000 |
|---|
| LogP | 11.07260 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | WUCNFXSTEJBBSR-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CCO)c1ccc(N=C2C(=O)N(c3c(Cl)cc(Cl)cc3Cl)N=C2NC(=O)c2cccc(NC(=O)COc3ccc(C(C)(C)CC)cc3C(C)(C)CC)c2)c(C)c1 |
|---|