Introduction：Basic information about CAS 97-10-9|4-(methylsulphonyl)-2-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(methylsulphonyl)-2-nitrophenol |
|---|
| CAS Number | 97-10-9 | Molecular Weight | 217.19900 |
|---|
| Density | 1.535g/cm3 | Boiling Point | 405.2ºC at 760mmHg |
|---|
| Molecular Formula | C7H7NO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.9ºC |
|---|
Names
| Name | 4-methylsulfonyl-2-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.535g/cm3 |
|---|
| Boiling Point | 405.2ºC at 760mmHg |
|---|
| Molecular Formula | C7H7NO5S |
|---|
| Molecular Weight | 217.19900 |
|---|
| Flash Point | 198.9ºC |
|---|
| Exact Mass | 217.00400 |
|---|
| PSA | 108.57000 |
|---|
| LogP | 2.30790 |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | WPYHDEFQVGUCQZ-UHFFFAOYSA-N |
|---|
| SMILES | CS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
|---|
Synonyms
| 4-Methansulfonyl-2-nitro-phenol |
| Methyl-<3-nitro-4-hydroxy-phenyl>-sulfon |
| 4-(Methylsulfonyl)-2-nitrophenol |
| 2-nitro-4-methylsulphonyl-phenol |
| 4-Hydroxy-3-nitrophenylmethylsulfon |
| 4-(Methylsulphonyl)-2-nitrophenol |
| 2-nitro-4-methylsulfonylphenol |
| 4-Methanesulfonyl-2-nitro-phenol |
