Introduction：Basic information about CAS 3426-01-5|1,4-diphenylpyrazolidine-3,5-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-diphenylpyrazolidine-3,5-dione |
|---|
| CAS Number | 3426-01-5 | Molecular Weight | 252.26800 |
|---|
| Density | 1.279g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C15H12N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,4-diphenylpyrazolidine-3,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.279g/cm3 |
|---|
| Molecular Formula | C15H12N2O2 |
|---|
| Molecular Weight | 252.26800 |
|---|
| Exact Mass | 252.09000 |
|---|
| PSA | 52.90000 |
|---|
| LogP | 2.18910 |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | ZZMSHBOVYPIYOB-UHFFFAOYSA-N |
|---|
| SMILES | O=C1NN(c2ccccc2)C(=O)C1c1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1,4-diphenyl-pyrazolidine-3,5-dione |
| 1,4-Diphenyl-3,5-diketopyrazolidon |
| EINECS 222-324-3 |
| 1,4-Diphenyl-pyrazolidin-3,5-dion |
| Phenopyrazone |
| 1,4-Diphenyl-3,5-diketopyrazolidin |
| 3,5-Pyrazolidinedione,1,4-diphenyl |
| Diphenox |
| DPHP |
| 1,4-Diphenyl-3,5-pyrazolidinedione |
| Kr 122 |
