Introduction：Basic information about CAS 459409-74-6|5-Phenylthiophene-2-boronic acid pinacol ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Phenylthiophene-2-boronic acid pinacol ester |
|---|
| CAS Number | 459409-74-6 | Molecular Weight | 286.197 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 409.3±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H19BO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.4±25.4 °C |
|---|
Names
| Name | 4,4,5,5-tetramethyl-2-(5-phenylthiophen-2-yl)-1,3,2-dioxaborolane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 409.3±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H19BO2S |
|---|
| Molecular Weight | 286.197 |
|---|
| Flash Point | 201.4±25.4 °C |
|---|
| Exact Mass | 286.119873 |
|---|
| PSA | 46.70000 |
|---|
| LogP | 3.71430 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.560 |
|---|
| InChIKey | BOTJOCNWKJVWRR-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OB(c2ccc(-c3ccccc3)s2)OC1(C)C |
|---|
Synonyms
| 4,4,5,5-Tetramethyl-2-(5-phenyl-2-thienyl)-1,3,2-dioxaborolane |
| 5-Phenylthiophene-2-boronic acid pinacol ester |
| 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(5-phenyl-2-thienyl)- |
| 2-Phenylthiophene-5-Boronic Acid Pinacol Ester |
