Introduction：Basic information about CAS 41663-84-7|2-methyl-5-nitro-isoindole-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-methyl-5-nitro-isoindole-1,3-dione |
|---|
| CAS Number | 41663-84-7 | Molecular Weight | 206.155 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 361.1±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6N2O4 | Melting Point | 94-98 °C(lit.) |
|---|
| MSDS | / | Flash Point | 172.2±23.2 °C |
|---|
Names
| Name | N-Methyl-4-nitrophthalimide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 361.1±25.0 °C at 760 mmHg |
|---|
| Melting Point | 94-98 °C(lit.) |
|---|
| Molecular Formula | C9H6N2O4 |
|---|
| Molecular Weight | 206.155 |
|---|
| Flash Point | 172.2±23.2 °C |
|---|
| Exact Mass | 206.032761 |
|---|
| PSA | 83.20000 |
|---|
| LogP | 1.29 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.648 |
|---|
| InChIKey | JBCHWGTZAAZJKG-UHFFFAOYSA-N |
|---|
| SMILES | CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | - |
|---|
| RTECS | NR3398541 |
|---|
| HS Code | 2925190090 |
|---|
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Methylnitrophthalimide |
| 2-Methyl-5-nitro-1H-isoindole-1,3(2H)-dione |
| 2-Methyl-5-nitro-1H-isoindole-1,3(2H)dione |
| 2-methyl-5-nitro-isoindole-1,3-dione |
| MFCD00454263 |
| 2-methyl-5-nitroisoindoline-1,3-dione |
| 4-Nitro-N-methylphthalimide |
| N-Methyl-4-nitrophthalimide |
| EINECS 255-483-2 |
| 1H-Isoindole-1,3(2H)-dione, 2-methyl-5-nitro- |
