Introduction:Basic information about CAS 13684-44-1|phenmedipham-ethyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | phenmedipham-ethyl |
|---|
| CAS Number | 13684-44-1 | Molecular Weight | 314.336 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 405.5±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H18N2O4 | Melting Point | 140-144ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 199.0±28.7 °C |
|---|
| Symbol | GHS09 | Signal Word | Warning |
|---|
Names
| Name | phenmedipham-ethyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 405.5±45.0 °C at 760 mmHg |
|---|
| Melting Point | 140-144ºC |
|---|
| Molecular Formula | C17H18N2O4 |
|---|
| Molecular Weight | 314.336 |
|---|
| Flash Point | 199.0±28.7 °C |
|---|
| Exact Mass | 314.126648 |
|---|
| PSA | 76.66000 |
|---|
| LogP | 3.99 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.629 |
|---|
| InChIKey | MVEFZZKZBYQFPP-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)Nc1cccc(OC(=O)Nc2cccc(C)c2)c1 |
|---|
Safety Information
| Symbol | GHS09 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H400 |
|---|
| Precautionary Statements | P273 |
|---|
| RIDADR | UN 3077 9 / PGIII |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| ethyl 3-(3-methylcarbaniloyloxy)carbanilate |
| phenmedipham-ethyl |
| UNII-Z56KWX34F9 |
| 3-[(Ethoxycarbonyl)amino]phenyl (3-methylphenyl)carbamate |
| Ethyl 3'-(3'-methylcarbaniloyloxy)carbanilate |
| [3-(ethoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate |
| 3-Ethoxycarbonylaminophenyl 3'-methylcarbanilate |
| 3-(ethoxyformamido)phenyl (3-methylphenyl)carbamate |
| 3-[(ethoxycarbonyl)amino]phenyl N-(3-methylphenyl)carbamate |
| 3-ethoxycarbonylaminophenyl 3-methylcarbanilate |