Introduction:Basic information about CAS 49690-63-3|Tris(2,4-Dibromo-phenyl) phosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tris(2,4-Dibromo-phenyl) phosphate |
|---|
| CAS Number | 49690-63-3 | Molecular Weight | 799.65900 |
|---|
| Density | 2.252g/cm3 | Boiling Point | 619.1ºC at 760mmHg |
|---|
| Molecular Formula | C18H9Br6O4P | Melting Point | 101ºC |
|---|
| MSDS | / | Flash Point | 328.2ºC |
|---|
Names
| Name | tris(2,3-dibromophenyl) phosphate |
|---|
Chemical & Physical Properties
| Density | 2.252g/cm3 |
|---|
| Boiling Point | 619.1ºC at 760mmHg |
|---|
| Melting Point | 101ºC |
|---|
| Molecular Formula | C18H9Br6O4P |
|---|
| Molecular Weight | 799.65900 |
|---|
| Flash Point | 328.2ºC |
|---|
| Exact Mass | 793.53400 |
|---|
| PSA | 54.57000 |
|---|
| LogP | 9.90650 |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | OZEDYCTUPMFWEP-UHFFFAOYSA-N |
|---|
| SMILES | O=P(Oc1ccc(Br)cc1Br)(Oc1ccc(Br)cc1Br)Oc1ccc(Br)cc1Br |
|---|