Introduction：Basic information about CAS 330562-46-4|1-bromoperfluoro-2,5-dioxanonane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-bromoperfluoro-2,5-dioxanonane |
|---|
| CAS Number | 330562-46-4 | Molecular Weight | 480.95400 |
|---|
| Density | 1.908g/cm3 | Boiling Point | 115ºC |
|---|
| Molecular Formula | C7BrF15O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 72.4ºC |
|---|
Names
| Name | 1-[2-[bromo(difluoro)methoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2,3,3,4,4,4-nonafluorobutane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.908g/cm3 |
|---|
| Boiling Point | 115ºC |
|---|
| Molecular Formula | C7BrF15O2 |
|---|
| Molecular Weight | 480.95400 |
|---|
| Flash Point | 72.4ºC |
|---|
| Exact Mass | 479.88400 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 5.57610 |
|---|
| Index of Refraction | 1.305 |
|---|
| InChIKey | AWVFMOQHHHUYSE-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(Br)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| MFCD03094416 |
| 1-Bromoperfluoro-2,5-dioxanonane |
| PC7126 |
