Introduction：Basic information about CAS 18052-76-1|1-Naphthyl Trimethoxysilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Naphthyl Trimethoxysilane |
|---|
| CAS Number | 18052-76-1 | Molecular Weight | 248.350 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 286.9±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16O3Si | Melting Point | 33-35ºC |
|---|
| MSDS | / | Flash Point | 127.8±26.2 °C |
|---|
Names
| Name | trimethoxy(naphthalen-1-yl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 286.9±9.0 °C at 760 mmHg |
|---|
| Melting Point | 33-35ºC |
|---|
| Molecular Formula | C13H16O3Si |
|---|
| Molecular Weight | 248.350 |
|---|
| Flash Point | 127.8±26.2 °C |
|---|
| Exact Mass | 248.086868 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 2.63 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | ZSOVVFMGSCDMIF-UHFFFAOYSA-N |
|---|
| SMILES | CO[Si](OC)(OC)c1cccc2ccccc12 |
|---|
Safety Information
Synonyms
| Trimethoxy(1-naphthyl)silane |
| 1-NAPHTHYLTRIMETHOXYSILANE |
| 1-naphthalenyl trimethoxysilane |
| Silane,trimethoxy-1-naphthalenyl |
| naphthalen-1-yl trimethoxysilane |
| Naphthalene, 1-(trimethoxysilyl)- |
| Naphthalene,1-(trimethoxysilyl) |
| 1-Naphthyl Trimethoxysilane |
