Introduction：Basic information about CAS 6522-74-3|Reactive Orange 1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Reactive Orange 1 |
|---|
| CAS Number | 6522-74-3 | Molecular Weight | 571.37100 |
|---|
| Density | 1.88g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C19H12Cl2N6O7S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Reactive Orange 1 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.88g/cm3 |
|---|
| Molecular Formula | C19H12Cl2N6O7S2 |
|---|
| Molecular Weight | 571.37100 |
|---|
| Exact Mass | 569.95900 |
|---|
| PSA | 221.15000 |
|---|
| LogP | 6.92420 |
|---|
| Index of Refraction | 1.798 |
|---|
| InChIKey | PXAHDGWGMUDBSR-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1ccccc1N=Nc1c(S(=O)(=O)O)cc2cc(Nc3nc(Cl)nc(Cl)n3)ccc2c1O |
|---|
Synonyms
| 2-Naphthalenesulfonic acid,7-[(4,6-dichloro-1,3,5-triazin-2-yl)amin-o]-4-hydroxy-3-[(2-sulfophenyl)azo] |
| 7-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(2-sulphophenyl)azo]naphthalene-2-sulphonic acid |
| Reactive brilliant orange X-GN y-3-[(2-sulfophenyl)azo]-7-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(2-sulfophenyl)azo]-2-naphthalenesulfonic acid |
| EINECS 229-412-0 |
| 2-Naphthalenesulfonic acid,7-((4,6-dichloro-1,3,5-triazin-2-yl)amino)-4-hydroxy-3-(2-(2-sulfophenyl)diazenyl) |
| (3E)-7-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-4-oxo-3-[(2-sulfophenyl)hydrazinylidene]naphthalene-2-sulfonic acid |
