Introduction：Basic information about CAS 82597-82-8|Cyclo(-Phe-Trp), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclo(-Phe-Trp) |
|---|
| CAS Number | 82597-82-8 | Molecular Weight | 333.38400 |
|---|
| Density | 1.279g/cm3 | Boiling Point | 705.5ºC at 760 mmHg |
|---|
| Molecular Formula | C20H19N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 380.5ºC |
|---|
Names
| Name | 3-benzyl-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.279g/cm3 |
|---|
| Boiling Point | 705.5ºC at 760 mmHg |
|---|
| Molecular Formula | C20H19N3O2 |
|---|
| Molecular Weight | 333.38400 |
|---|
| Flash Point | 380.5ºC |
|---|
| Exact Mass | 333.14800 |
|---|
| PSA | 73.99000 |
|---|
| LogP | 2.59390 |
|---|
| Index of Refraction | 1.658 |
|---|
| InChIKey | CUVKAUWOMPJEMI-UHFFFAOYSA-N |
|---|
| SMILES | O=C1NC(Cc2c[nH]c3ccccc23)C(=O)NC1Cc1ccccc1 |
|---|
Synonyms
| cyclo-(L)-Trp-(L)-Phe |
| cyclo(L-tryptophyl-L-phenylalanyl) |
| 2,5-Piperazinedione,3-(1H-indol-3-ylmethyl)-6-(phenylmethyl) |
| 3-[(1H-indol-3-yl)methyl]-6-benzylpiperazine-2,5-dione |
| Cyclo(-Phe-Trp) |
