Introduction：Basic information about CAS 3331-47-3|7-Isopropyl-1,4-dimethylazulene-3-carboxaldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Isopropyl-1,4-dimethylazulene-3-carboxaldehyde |
|---|
| CAS Number | 3331-47-3 | Molecular Weight | 226.31400 |
|---|
| Density | 1.038g/cm3 | Boiling Point | 364.2ºC at 760mmHg |
|---|
| Molecular Formula | C16H18O | Melting Point | 83 °C |
|---|
| MSDS | / | Flash Point | 180.2ºC |
|---|
Names
| Name | 3,8-dimethyl-5-propan-2-ylazulene-1-carbaldehyde |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.038g/cm3 |
|---|
| Boiling Point | 364.2ºC at 760mmHg |
|---|
| Melting Point | 83 °C |
|---|
| Molecular Formula | C16H18O |
|---|
| Molecular Weight | 226.31400 |
|---|
| Flash Point | 180.2ºC |
|---|
| Exact Mass | 226.13600 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.34410 |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | CDVRGGMPPUFSFH-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C=O)c2c(C)ccc(C(C)C)cc1-2 |
|---|
Safety Information
Customs
| HS Code | 2912299000 |
|---|
| Summary | 2912299000. other cyclic aldehydes without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| 1-formylguaiazulene |
| Guiazulene-1-carboxaldehyde |
| 5-isopropyl-3,8-dimethylazulene-1-carbaldehyde |
| quiazulene-1-carboxaldehyde |
| 3-formylguaiazulene |
| 3-guaiazulenecarbaldehyde |
| guaiazulene-1-carboxaldehyde |
| guaiazulene-3-carbaldehyde |
| 7-Isopropyl-1,4-dimethylazulene-3-carboxaldehyde |
