Introduction:Basic information about CAS 58457-24-2|5-Chloro-4-nitro-2-thiophenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Chloro-4-nitro-2-thiophenesulfonyl chloride |
|---|
| CAS Number | 58457-24-2 | Molecular Weight | 262.091 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 398.4±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C4HCl2NO4S2 | Melting Point | 51 °C |
|---|
| MSDS | USA | Flash Point | 194.8±27.9 °C |
|---|
Names
| Name | 5-chloro-4-nitrothiophene-2-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 398.4±42.0 °C at 760 mmHg |
|---|
| Melting Point | 51 °C |
|---|
| Molecular Formula | C4HCl2NO4S2 |
|---|
| Molecular Weight | 262.091 |
|---|
| Flash Point | 194.8±27.9 °C |
|---|
| Exact Mass | 260.872406 |
|---|
| PSA | 116.58000 |
|---|
| LogP | 2.53 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | SGHAHFHTASPNKN-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Cl)sc1Cl |
|---|
Safety Information
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN3096 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-Chloro-4-nitro-2-thiophenesulfonyl chloride |
| 2-Thiophenesulfonyl chloride, 5-chloro-4-nitro- |
| 5-chloro-4-nitro-thien-2-ylsulfonyl chloride |
| 5-chloro-4-nitro-2-thienylsulfonyl chloride |
| 5-chloro-4-nitrothiophene-2-sulfonyl chloride |
| 5-chloro-4-nitro-thiophene-2-sulfonyl chloride |
| chloro(5-chloro-4-nitro(2-thienyl))sulfone |
| 2-chloro-3-nitrothiophene-5-sulphonyl chloride |
| 2-chlorosulphonyl-4-nitro-5-chlorothiophene |
| 5-Chlor-4-nitro-thiophen-2-sulfonylchlorid |
| MFCD00067978 |