Introduction：Basic information about CAS 18801-63-3|Benzene,1,2,3,4-tetramethyl-5,6-dinitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,1,2,3,4-tetramethyl-5,6-dinitro- |
|---|
| CAS Number | 18801-63-3 | Molecular Weight | 224.21300 |
|---|
| Density | 1.258g/cm3 | Boiling Point | 389.7ºC at 760mmHg |
|---|
| Molecular Formula | C10H12N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.3ºC |
|---|
Names
| Name | 1,2,3,4-tetramethyl-5,6-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.258g/cm3 |
|---|
| Boiling Point | 389.7ºC at 760mmHg |
|---|
| Molecular Formula | C10H12N2O4 |
|---|
| Molecular Weight | 224.21300 |
|---|
| Flash Point | 191.3ºC |
|---|
| Exact Mass | 224.08000 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 3.78300 |
|---|
| Vapour Pressure | 6.28E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | OVFWWDRGWIAOIT-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(C)c(C)c([N+](=O)[O-])c([N+](=O)[O-])c1C |
|---|
Safety Information
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1,2-Dinitro-3,4,5,6-tetramethylbenzen |
| 1,2-dinitrotetramethylbenzene |
| dinitroprehnitene |
| ortho-dinitrotetramethylbenzene |
| 3,4,5,6-tetramethyl-1,2-dinitrobenzene |
| 1,2,3,4-Tetramethyl-5,6-dinitrobenzol |
| 1,2-dinitro-3,4,5,6-tetramethylbenzene |
