CAS 338-84-1|Perfluorotripentylamine
Introduction:Basic information about CAS 338-84-1|Perfluorotripentylamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Perfluorotripentylamine | ||
|---|---|---|---|
| CAS Number | 338-84-1 | Molecular Weight | 821.115 |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 235.9±40.0 °C at 760 mmHg |
| Molecular Formula | C15F33N | Melting Point | -25 |
| MSDS | USA | Flash Point | 96.5±27.3 °C |
Names
| Name | 1,1,2,2,3,3,4,4,5,5,5-undecafluoro-N,N-bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)pentan-1-amine |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 235.9±40.0 °C at 760 mmHg |
| Melting Point | -25 |
| Molecular Formula | C15F33N |
| Molecular Weight | 821.115 |
| Flash Point | 96.5±27.3 °C |
| Exact Mass | 820.950378 |
| PSA | 3.24000 |
| LogP | 21.49 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.275 |
| InChIKey | AQZYBQIAUSKCCS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Storage condition | 2-8°C |
| Water Solubility | insoluble |
Safety Information
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R53 |
| Safety Phrases | S26-S36-S61 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
Synonyms
| Fluorinert(R) FC-70 |
| 1-Pentanamine,1,1,2,2,3,3,4,4,5,5,5-undecafluoro-N,N-bis(undecafluoropentyl) |
| 1,1,2,2,3,3,4,4,5,5,5-Undecafluoro-N,N-bis(undecafluoropentyl)-1-pentanamine |
| 1-Pentanamine, 1,1,2,2,3,3,4,4,5,5,5-undecafluoro-N,N-bis(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)- |
| 1-Pentanamine, 1,1,2,2,3,3,4,4,5,5,5-undecafluoro-N,N-bis(undecafluoropentyl)- |
| Perfluorotripentylamine |
| EINECS 206-421-8 |
| perfluorotri-n-pentylamine |
| perfluoro-compound fc-70 |
| 1,1,2,2,3,3,4,4,5,5,5-undecafluoro-n,n-bis(undecafluoropentyl)pentan-1-amine |
| Perfluorotriamylamine |
| Tris(undecafluoropentyl)amine |
| Fluorinert FC-70 |
| Perfluoro-compound FC-70§3 |
| MFCD00042367 |
